Products 2306272-12-6

CAS 2306272-12-6 is the registry number for 7-Bromo-4H-benzo[b]imidazo[1,2-d][1,4]oxazine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-bromo-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylic acid (CAS 2306272-12-6) is a chemical compound with the molecular formula C11H7BrN2O3 and a molecular weight of 295.09 g/mol. IUPAC name: 7-bromo-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylic acid. InChIKey: GYVWLLSHNCEXPF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7BrN2O3
Molecular weight295.09 g/mol
IUPAC name7-bromo-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylic acid
InChIKeyGYVWLLSHNCEXPF-UHFFFAOYSA-N
SMILESC1C2=NC(=CN2C3=C(O1)C=C(C=C3)Br)C(=O)O

Computed by PubChem (NCBI)