Products 2489686-94-2
CAS 2489686-94-2 is the registry number for (R)-5'-Bromospiro[imidazolidine-4,1'-indene]-2,3',5(2'H)-trione, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg.
(3R)-6-bromospiro[2H-indene-3,5'-imidazolidine]-1,2',4'-trione (CAS 2489686-94-2) is a chemical compound with the molecular formula C11H7BrN2O3 and a molecular weight of 295.09 g/mol. IUPAC name: (3R)-6-bromospiro[2H-indene-3,5'-imidazolidine]-1,2',4'-trione. InChIKey: MWDLWLPHIPRYNP-LLVKDONJSA-N.
| Molecular formula | C11H7BrN2O3 |
|---|---|
| Molecular weight | 295.09 g/mol |
| IUPAC name | (3R)-6-bromospiro[2H-indene-3,5'-imidazolidine]-1,2',4'-trione |
| InChIKey | MWDLWLPHIPRYNP-LLVKDONJSA-N |
| SMILES | C1C(=O)C2=C([C@@]13C(=O)NC(=O)N3)C=CC(=C2)Br |
Computed by PubChem (NCBI)