Products 1086379-59-0

CAS 1086379-59-0 is the registry number for 3-((5-Bromopyrimidin-2-yl)oxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(5-bromopyrimidin-2-yl)oxybenzoic acid (CAS 1086379-59-0) is a chemical compound with the molecular formula C11H7BrN2O3 and a molecular weight of 295.09 g/mol. IUPAC name: 3-(5-bromopyrimidin-2-yl)oxybenzoic acid. InChIKey: HPJFSTPVQIPYMN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7BrN2O3
Molecular weight295.09 g/mol
IUPAC name3-(5-bromopyrimidin-2-yl)oxybenzoic acid
InChIKeyHPJFSTPVQIPYMN-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)OC2=NC=C(C=N2)Br)C(=O)O

Computed by PubChem (NCBI)