CAS 1889290-24-7 appears in our catalog under these names: 5'-Bromospiro[imidazolidine-4,1'-indene]-2,3',5(2'H)-trione, 98%, 5'-Bromospiro(imidazolidine-4,1'-(1H)indene)-2,3',5(2'H)-trione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
6-bromospiro[2H-indene-3,5'-imidazolidine]-1,2',4'-trione (CAS 1889290-24-7) is a chemical compound with the molecular formula C11H7BrN2O3 and a molecular weight of 295.09 g/mol. IUPAC name: 6-bromospiro[2H-indene-3,5'-imidazolidine]-1,2',4'-trione. InChIKey: MWDLWLPHIPRYNP-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2O3 |
|---|---|
| Molecular weight | 295.09 g/mol |
| IUPAC name | 6-bromospiro[2H-indene-3,5'-imidazolidine]-1,2',4'-trione |
| InChIKey | MWDLWLPHIPRYNP-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C13C(=O)NC(=O)N3)C=CC(=C2)Br |
Computed by PubChem (NCBI)