Products 1086379-95-4
CAS 1086379-95-4 appears in our catalog under these names: 2-(Furan-2-yl)isonicotinic acid, 95%, 2-(Furan-2-yl)isonicotinic acid, 98+%, 2-(2-Furyl)isonicotinic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 0,5g.
2-(furan-2-yl)pyridine-4-carboxylic acid (CAS 1086379-95-4) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-(furan-2-yl)pyridine-4-carboxylic acid. InChIKey: RDJBDQGUVODXPZ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-(furan-2-yl)pyridine-4-carboxylic acid |
| InChIKey | RDJBDQGUVODXPZ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)