CAS 1087345-72-9 appears in our catalog under these names: 2-(1-Aminoethyl)-1,3-thiazole-4-carboxylic acid hydrochloride, 95%, 2-(1-Aminoethyl)-1,3-thiazole-4-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(1-aminoethyl)-1,3-thiazole-4-carboxylic acid;hydrochloride (CAS 1087345-72-9) is a chemical compound with the molecular formula C6H9ClN2O2S and a molecular weight of 208.67 g/mol. IUPAC name: 2-(1-aminoethyl)-1,3-thiazole-4-carboxylic acid;hydrochloride. InChIKey: HBMKYYNJCYQFKF-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O2S |
|---|---|
| Molecular weight | 208.67 g/mol |
| IUPAC name | 2-(1-aminoethyl)-1,3-thiazole-4-carboxylic acid;hydrochloride |
| InChIKey | HBMKYYNJCYQFKF-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=CS1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)