CAS 1087784-33-5 is the registry number for 2-{1,4-dimethyl-3,6-dioxo-1H,2H,3H,6H,7H-pyrazolo(3,4-b)pyridin-5-yl}acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(1,4-dimethyl-3,6-dioxo-2,7-dihydropyrazolo[3,4-b]pyridin-5-yl)acetic acid (CAS 1087784-33-5) is a chemical compound with the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. IUPAC name: 2-(1,4-dimethyl-3,6-dioxo-2,7-dihydropyrazolo[3,4-b]pyridin-5-yl)acetic acid. InChIKey: PVQWSVYOYNRFSJ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O4 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | 2-(1,4-dimethyl-3,6-dioxo-2,7-dihydropyrazolo[3,4-b]pyridin-5-yl)acetic acid |
| InChIKey | PVQWSVYOYNRFSJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC2=C1C(=O)NN2C)CC(=O)O |
Computed by PubChem (NCBI)