Products 2760568-81-6
CAS 2760568-81-6 is the registry number for Ethyl 2-((5-carbamoylpyridin-3-yl)amino)-2-oxoacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[(5-carbamoyl-3-pyridinyl)amino]-2-oxoacetate (CAS 2760568-81-6) is a chemical compound with the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. IUPAC name: ethyl 2-[(5-carbamoyl-3-pyridinyl)amino]-2-oxoacetate. InChIKey: NFHIGVTTZWWHFR-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O4 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | ethyl 2-[(5-carbamoyl-3-pyridinyl)amino]-2-oxoacetate |
| InChIKey | NFHIGVTTZWWHFR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=CN=CC(=C1)C(=O)N |
Computed by PubChem (NCBI)