Products 2814504-20-4
CAS 2814504-20-4 is the registry number for Baloxavir Marboxil Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (CAS 2814504-20-4) is a chemical compound with the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. IUPAC name: (3R)-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione. InChIKey: RSHPQBYMCLMJOU-ZETCQYMHSA-N.
| Molecular formula | C10H11N3O4 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | (3R)-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| InChIKey | RSHPQBYMCLMJOU-ZETCQYMHSA-N |
| SMILES | C1COC[C@@H]2N1C(=O)C3=C(C(=O)C=CN3N2)O |
Computed by PubChem (NCBI)
Synonyms:
Barloxavir impurity 81