CAS 1214-75-1 is the registry number for 2-(2,4-Dinitrophenyl)-N,N-dimethylethen-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dinitrophenyl)-N,N-dimethylethenamine (CAS 1214-75-1) is a chemical compound with the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. IUPAC name: 2-(2,4-dinitrophenyl)-N,N-dimethylethenamine. InChIKey: MHIRUPHZSNZDCI-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O4 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | 2-(2,4-dinitrophenyl)-N,N-dimethylethenamine |
| InChIKey | MHIRUPHZSNZDCI-UHFFFAOYSA-N |
| SMILES | CN(C)C=CC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)