Products 177494-02-9
CAS 177494-02-9 is the registry number for 2,4-Dinitro-5,6,7,8-tetrahydronaphthalen-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dinitro-5,6,7,8-tetrahydronaphthalen-1-amine (CAS 177494-02-9) is a chemical compound with the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. IUPAC name: 2,4-dinitro-5,6,7,8-tetrahydronaphthalen-1-amine. InChIKey: GCPUZSSKWKCIMT-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O4 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | 2,4-dinitro-5,6,7,8-tetrahydronaphthalen-1-amine |
| InChIKey | GCPUZSSKWKCIMT-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=CC(=C2N)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)