Products 108800-18-6

CAS 108800-18-6 is the registry number for 1-(3-(Benzyloxy)phenyl)guanidine nitrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Nitric acid;2-(3-phenylmethoxyphenyl)guanidine (CAS 108800-18-6) is a chemical compound with the molecular formula C14H16N4O4 and a molecular weight of 304.30 g/mol. IUPAC name: nitric acid;2-(3-phenylmethoxyphenyl)guanidine. InChIKey: RLYLPKVVZWBQJH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N4O4
Molecular weight304.30 g/mol
IUPAC namenitric acid;2-(3-phenylmethoxyphenyl)guanidine
InChIKeyRLYLPKVVZWBQJH-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC=CC(=C2)N=C(N)N.[N+](=O)(O)[O-]

Computed by PubChem (NCBI)