CAS 108800-18-6 is the registry number for 1-(3-(Benzyloxy)phenyl)guanidine nitrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Nitric acid;2-(3-phenylmethoxyphenyl)guanidine (CAS 108800-18-6) is a chemical compound with the molecular formula C14H16N4O4 and a molecular weight of 304.30 g/mol. IUPAC name: nitric acid;2-(3-phenylmethoxyphenyl)guanidine. InChIKey: RLYLPKVVZWBQJH-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O4 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | nitric acid;2-(3-phenylmethoxyphenyl)guanidine |
| InChIKey | RLYLPKVVZWBQJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)N=C(N)N.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)