CAS 2396427-54-4 is the registry number for 4-((tert-Butoxycarbonyl)amino)-1-phenyl-1H-1,2,3-triazole-5-carboxylic acid, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 50mg, 100mg.
5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenyltriazole-4-carboxylic acid (CAS 2396427-54-4) is a chemical compound with the molecular formula C14H16N4O4 and a molecular weight of 304.30 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenyltriazole-4-carboxylic acid. InChIKey: RJLMZTOVOASPOR-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O4 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenyltriazole-4-carboxylic acid |
| InChIKey | RJLMZTOVOASPOR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(N(N=N1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)