CAS 92695-32-4 is the registry number for 2,7-Diaminomitosene (>85%), >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
[(2R)-2,6-diamino-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]methyl carbamate (CAS 92695-32-4) is a chemical compound with the molecular formula C14H16N4O4 and a molecular weight of 304.30 g/mol. IUPAC name: [(2R)-2,6-diamino-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]methyl carbamate. InChIKey: SMCLMIIQNWUTHU-ZCFIWIBFSA-N.
| Molecular formula | C14H16N4O4 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | [(2R)-2,6-diamino-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]methyl carbamate |
| InChIKey | SMCLMIIQNWUTHU-ZCFIWIBFSA-N |
| SMILES | CC1=C(C(=O)C2=C(C1=O)N3C[C@@H](CC3=C2COC(=O)N)N)N |
Computed by PubChem (NCBI)