CAS 849484-94-2 is the registry number for Ethyl 4-(2-cyano-4-nitrophenyl)piperazine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 4-(2-cyano-4-nitrophenyl)piperazine-1-carboxylate (CAS 849484-94-2) is a chemical compound with the molecular formula C14H16N4O4 and a molecular weight of 304.30 g/mol. IUPAC name: ethyl 4-(2-cyano-4-nitrophenyl)piperazine-1-carboxylate. InChIKey: GSZRXMRHQAQEFZ-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O4 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | ethyl 4-(2-cyano-4-nitrophenyl)piperazine-1-carboxylate |
| InChIKey | GSZRXMRHQAQEFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCN(CC1)C2=C(C=C(C=C2)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)