CAS 78598-43-3 is the registry number for 2,7-diaminomitosene. Offered by: Chemat Brand. Available pack sizes: on request.
(2,6-diamino-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl)methyl carbamate (CAS 78598-43-3) is a chemical compound with the molecular formula C14H16N4O4 and a molecular weight of 304.30 g/mol. IUPAC name: (2,6-diamino-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl)methyl carbamate. InChIKey: SMCLMIIQNWUTHU-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O4 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | (2,6-diamino-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl)methyl carbamate |
| InChIKey | SMCLMIIQNWUTHU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=C(C1=O)N3CC(CC3=C2COC(=O)N)N)N |
Computed by PubChem (NCBI)