Products 108838-88-6
CAS 108838-88-6 is the registry number for 1-(3-methoxyphenyl)-3-((4-methylphenyl)sulfonyl)urea. Offered by: Biosynth. Available pack sizes: 250mg.
1-(3-methoxyphenyl)-3-(4-methylphenyl)sulfonylurea (CAS 108838-88-6) is a chemical compound with the molecular formula C15H16N2O4S and a molecular weight of 320.4 g/mol. IUPAC name: 1-(3-methoxyphenyl)-3-(4-methylphenyl)sulfonylurea. InChIKey: NNHNQYJJIZILAV-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O4S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)-3-(4-methylphenyl)sulfonylurea |
| InChIKey | NNHNQYJJIZILAV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)