CAS 19838-01-8 appears in our catalog under these names: N-[4-[[(2-Methoxyphenyl)amino]sulfonyl]phenyl]acetamide, 96%, 96%, 4'-(2-METHOXYPHENYLSULFAMOYL)ACETANILIDE. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
N-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]acetamide (CAS 19838-01-8) is a chemical compound with the molecular formula C15H16N2O4S and a molecular weight of 320.4 g/mol. IUPAC name: N-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]acetamide. InChIKey: WPBSECKAKWJQLM-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O4S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | N-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]acetamide |
| InChIKey | WPBSECKAKWJQLM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2OC |
Computed by PubChem (NCBI)