Products 2254801-56-2
CAS 2254801-56-2 is the registry number for 4-(2-((tert-Butoxycarbonyl)amino)thiazol-4-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]benzoic acid (CAS 2254801-56-2) is a chemical compound with the molecular formula C15H16N2O4S and a molecular weight of 320.4 g/mol. IUPAC name: 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]benzoic acid. InChIKey: HIFSILACZGJFBV-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O4S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]benzoic acid |
| InChIKey | HIFSILACZGJFBV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=CS1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)