Products 790271-22-6
CAS 790271-22-6 appears in our catalog under these names: N-(4-Aminophenyl)-3,4-dihydro-2h-1,5-benzodioxepine-7-sulfonamide, 95%, N-(4-Aminophenyl)-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N-(4-aminophenyl)-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide (CAS 790271-22-6) is a chemical compound with the molecular formula C15H16N2O4S and a molecular weight of 320.4 g/mol. IUPAC name: N-(4-aminophenyl)-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide. InChIKey: JAODYQUJLOXKCH-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O4S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | N-(4-aminophenyl)-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
| InChIKey | JAODYQUJLOXKCH-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)S(=O)(=O)NC3=CC=C(C=C3)N)OC1 |
Computed by PubChem (NCBI)