Products 296274-06-1
CAS 296274-06-1 is the registry number for N-(2,3-Dimethylphenyl)-4-methyl-3-nitrobenzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(2,3-dimethylphenyl)-4-methyl-3-nitrobenzenesulfonamide (CAS 296274-06-1) is a chemical compound with the molecular formula C15H16N2O4S and a molecular weight of 320.4 g/mol. IUPAC name: N-(2,3-dimethylphenyl)-4-methyl-3-nitrobenzenesulfonamide. InChIKey: VAODENZUKGGONH-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O4S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | N-(2,3-dimethylphenyl)-4-methyl-3-nitrobenzenesulfonamide |
| InChIKey | VAODENZUKGGONH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NS(=O)(=O)C2=CC(=C(C=C2)C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)