Products 108906-59-8
CAS 108906-59-8 is the registry number for Ac-Phe-Thiaphe-OH. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, Get quote.
(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-phenylsulfanylacetic acid (CAS 108906-59-8) is a chemical compound with the molecular formula C19H20N2O4S and a molecular weight of 372.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-phenylsulfanylacetic acid. InChIKey: ZIRMREOJJGMRIJ-WMZOPIPTSA-N.
| Molecular formula | C19H20N2O4S |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-phenylsulfanylacetic acid |
| InChIKey | ZIRMREOJJGMRIJ-WMZOPIPTSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@H](C(=O)O)SC2=CC=CC=C2 |
Computed by PubChem (NCBI)