Products 108909-02-0
CAS 108909-02-0 appears in our catalog under these names: Confusarin, Confusarin, 98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 10 mg, 5 mg, 1mg, 5mg.
1,5,6-trimethoxyphenanthrene-2,7-diol (CAS 108909-02-0) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: 1,5,6-trimethoxyphenanthrene-2,7-diol. InChIKey: JHNVCKNCEVZGGC-UHFFFAOYSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | 1,5,6-trimethoxyphenanthrene-2,7-diol |
| InChIKey | JHNVCKNCEVZGGC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=C1C=CC3=CC(=C(C(=C32)OC)OC)O)O |
Computed by PubChem (NCBI)