CAS 20621-49-2 appears in our catalog under these names: 2',6'-Dihydroxy-4,4'-dimethoxychalcone, 2',6'-Dihydroxy-4,4'-dimethoxychalcone, 95%. Offered by: TRC, MedChemExpress, Combi-blocks. Available pack sizes: 500mg, Get quote, 1g, 5g.
(E)-1-(2,6-dihydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one (CAS 20621-49-2) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: (E)-1-(2,6-dihydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: NXHNEWMDVUHUCV-VMPITWQZSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | (E)-1-(2,6-dihydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | NXHNEWMDVUHUCV-VMPITWQZSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)C2=C(C=C(C=C2O)OC)O |
Computed by PubChem (NCBI)