CAS 1776-28-9 appears in our catalog under these names: 2,2'-Dihydroxy-4',6'-dimethoxychalcone, 95%, 2,2'-Dihydroxy-4',6'-dimethoxychalcone, 2,2'-Dihydroxy-4',6'-dimethoxychalcone, min. 95 %, 100 mg, 2,2'-Dihydroxy-4',6'-dimethoxychalcone, min. 95 %, 250 mg, 2,2'-Dihydroxy-4',6'-dimethoxychalcone, min. 95 %, 500 mg. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg, 1000mg.
(E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(2-hydroxyphenyl)prop-2-en-1-one (CAS 1776-28-9) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(2-hydroxyphenyl)prop-2-en-1-one. InChIKey: ONIYXBSQSPCBOF-BQYQJAHWSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(2-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | ONIYXBSQSPCBOF-BQYQJAHWSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)/C=C/C2=CC=CC=C2O)O |
Computed by PubChem (NCBI)