CAS 137571-74-5 is the registry number for 7-(Benzyloxy)-5-hydroxy-2,2-dimethyl-4H-benzo[d][1,3]dioxin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-hydroxy-2,2-dimethyl-7-phenylmethoxy-1,3-benzodioxin-4-one (CAS 137571-74-5) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: 5-hydroxy-2,2-dimethyl-7-phenylmethoxy-1,3-benzodioxin-4-one. InChIKey: KWTSNZKEEZRRSU-UHFFFAOYSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | 5-hydroxy-2,2-dimethyl-7-phenylmethoxy-1,3-benzodioxin-4-one |
| InChIKey | KWTSNZKEEZRRSU-UHFFFAOYSA-N |
| SMILES | CC1(OC2=CC(=CC(=C2C(=O)O1)O)OCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)