Products 1820618-09-4

CAS 1820618-09-4 is the registry number for methyl 3-methoxy-5-[4-(methoxycarbonyl)phenyl]benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 3-methoxy-5-(4-methoxycarbonylphenyl)benzoate (CAS 1820618-09-4) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: methyl 3-methoxy-5-(4-methoxycarbonylphenyl)benzoate. InChIKey: SEYGEGOAUCAUKY-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16O5
Molecular weight300.30 g/mol
IUPAC namemethyl 3-methoxy-5-(4-methoxycarbonylphenyl)benzoate
InChIKeySEYGEGOAUCAUKY-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1)C(=O)OC)C2=CC=C(C=C2)C(=O)OC

Computed by PubChem (NCBI)