Products 1089630-38-5
CAS 1089630-38-5 is the registry number for N-(sec-Butyl)-4-chloro-2-nitrobenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-butan-2-yl-4-chloro-2-nitrobenzenesulfonamide (CAS 1089630-38-5) is a chemical compound with the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. IUPAC name: N-butan-2-yl-4-chloro-2-nitrobenzenesulfonamide. InChIKey: KADJUNYDEIPPRZ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O4S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | N-butan-2-yl-4-chloro-2-nitrobenzenesulfonamide |
| InChIKey | KADJUNYDEIPPRZ-UHFFFAOYSA-N |
| SMILES | CCC(C)NS(=O)(=O)C1=C(C=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)