Products 1172493-99-0
CAS 1172493-99-0 appears in our catalog under these names: 4-(Aminosulphonyl)benzoyl chloride dmf complex, 95%, 4-Sulfamidobenzoyl chloride DMF complex, 95% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 25g, 1g.
N,N-dimethylformamide;4-sulfamoylbenzoyl chloride (CAS 1172493-99-0) is a chemical compound with the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. IUPAC name: N,N-dimethylformamide;4-sulfamoylbenzoyl chloride. InChIKey: CRGFLVSVHAHYCI-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O4S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | N,N-dimethylformamide;4-sulfamoylbenzoyl chloride |
| InChIKey | CRGFLVSVHAHYCI-UHFFFAOYSA-N |
| SMILES | CN(C)C=O.C1=CC(=CC=C1C(=O)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)