CAS 1152972-29-6 appears in our catalog under these names: 5-Chloro-1-(1,1-dioxidotetrahydrothiophen-3-yl)-3-ethyl-1H-pyrazole-4-carboxylic acid, 95%, 5-chloro-1-(1,1-dioxothiolan-3-yl)-3-ethylpyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chloro-1-(1,1-dioxothiolan-3-yl)-3-ethylpyrazole-4-carboxylic acid (CAS 1152972-29-6) is a chemical compound with the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. IUPAC name: 5-chloro-1-(1,1-dioxothiolan-3-yl)-3-ethylpyrazole-4-carboxylic acid. InChIKey: VKIQVYLJTOMYPJ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O4S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | 5-chloro-1-(1,1-dioxothiolan-3-yl)-3-ethylpyrazole-4-carboxylic acid |
| InChIKey | VKIQVYLJTOMYPJ-UHFFFAOYSA-N |
| SMILES | CCC1=NN(C(=C1C(=O)O)Cl)C2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)