CAS 804482-36-8 is the registry number for Methyl 2-((tert-butoxycarbonyl)amino)-4-chlorothiazole-5-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 4-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylate (CAS 804482-36-8) is a chemical compound with the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. IUPAC name: methyl 4-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylate. InChIKey: LLFPBHPPKRRNMQ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O4S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | methyl 4-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylate |
| InChIKey | LLFPBHPPKRRNMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=C(S1)C(=O)OC)Cl |
Computed by PubChem (NCBI)