Products 2940947-72-6
CAS 2940947-72-6 is the registry number for tert-butyl 5-chloro-2-methylsulfonyl-pyrimidine-4-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 5-chloro-2-methylsulfonylpyrimidine-4-carboxylate (CAS 2940947-72-6) is a chemical compound with the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. IUPAC name: tert-butyl 5-chloro-2-methylsulfonylpyrimidine-4-carboxylate. InChIKey: GOTUKDKSSIVJNJ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O4S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | tert-butyl 5-chloro-2-methylsulfonylpyrimidine-4-carboxylate |
| InChIKey | GOTUKDKSSIVJNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC(=NC=C1Cl)S(=O)(=O)C |
Computed by PubChem (NCBI)