CAS 1089640-88-9 is the registry number for 2-Bromo-N-cyclopentyl-N,4-dimethylbenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-cyclopentyl-N,4-dimethylbenzenesulfonamide (CAS 1089640-88-9) is a chemical compound with the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. IUPAC name: 2-bromo-N-cyclopentyl-N,4-dimethylbenzenesulfonamide. InChIKey: ILGYTQBFJIKZLO-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO2S |
|---|---|
| Molecular weight | 332.26 g/mol |
| IUPAC name | 2-bromo-N-cyclopentyl-N,4-dimethylbenzenesulfonamide |
| InChIKey | ILGYTQBFJIKZLO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)N(C)C2CCCC2)Br |
Computed by PubChem (NCBI)