CAS 852228-52-5 is the registry number for 3-Bromo-N-(cyclohexylmethyl)benzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-N-(cyclohexylmethyl)benzenesulfonamide (CAS 852228-52-5) is a chemical compound with the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. IUPAC name: 3-bromo-N-(cyclohexylmethyl)benzenesulfonamide. InChIKey: XRILEXBAOOMFFY-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO2S |
|---|---|
| Molecular weight | 332.26 g/mol |
| IUPAC name | 3-bromo-N-(cyclohexylmethyl)benzenesulfonamide |
| InChIKey | XRILEXBAOOMFFY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)CNS(=O)(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)