Products 2270905-79-6
CAS 2270905-79-6 is the registry number for (4-Bromo-thiophen-2-ylmethyl)-cyclopropyl-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Tert-butyl N-[(4-bromothiophen-2-yl)methyl]-N-cyclopropylcarbamate (CAS 2270905-79-6) is a chemical compound with the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. IUPAC name: tert-butyl N-[(4-bromothiophen-2-yl)methyl]-N-cyclopropylcarbamate. InChIKey: PYPIAXHWRWTOIK-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO2S |
|---|---|
| Molecular weight | 332.26 g/mol |
| IUPAC name | tert-butyl N-[(4-bromothiophen-2-yl)methyl]-N-cyclopropylcarbamate |
| InChIKey | PYPIAXHWRWTOIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC1=CC(=CS1)Br)C2CC2 |
Computed by PubChem (NCBI)