Products 2205505-58-2
CAS 2205505-58-2 is the registry number for 5-Bromo-2-isopropylsulfanyl-nicotinic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 5-bromo-2-propan-2-ylsulfanylpyridine-3-carboxylate (CAS 2205505-58-2) is a chemical compound with the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. IUPAC name: tert-butyl 5-bromo-2-propan-2-ylsulfanylpyridine-3-carboxylate. InChIKey: CBBZFTFTQMJOBA-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO2S |
|---|---|
| Molecular weight | 332.26 g/mol |
| IUPAC name | tert-butyl 5-bromo-2-propan-2-ylsulfanylpyridine-3-carboxylate |
| InChIKey | CBBZFTFTQMJOBA-UHFFFAOYSA-N |
| SMILES | CC(C)SC1=C(C=C(C=N1)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)