CAS 2243521-77-7 is the registry number for tert-Butyl 2-bromo-4H,5H,6H,7H,8H-thieno(3,2-c)azepine-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 2-bromo-4,6,7,8-tetrahydrothieno[3,2-c]azepine-5-carboxylate (CAS 2243521-77-7) is a chemical compound with the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. IUPAC name: tert-butyl 2-bromo-4,6,7,8-tetrahydrothieno[3,2-c]azepine-5-carboxylate. InChIKey: NICKSXKGRYQRJX-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO2S |
|---|---|
| Molecular weight | 332.26 g/mol |
| IUPAC name | tert-butyl 2-bromo-4,6,7,8-tetrahydrothieno[3,2-c]azepine-5-carboxylate |
| InChIKey | NICKSXKGRYQRJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C(C1)C=C(S2)Br |
Computed by PubChem (NCBI)