CAS 1089642-31-8 is the registry number for N-Methyl-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-7-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-3-oxo-4H-1,4-benzoxazine-7-carboxamide (CAS 1089642-31-8) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: N-methyl-3-oxo-4H-1,4-benzoxazine-7-carboxamide. InChIKey: MODNKUGEQVOIBO-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | N-methyl-3-oxo-4H-1,4-benzoxazine-7-carboxamide |
| InChIKey | MODNKUGEQVOIBO-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC2=C(C=C1)NC(=O)CO2 |
Computed by PubChem (NCBI)