CAS 1089681-42-4 is the registry number for KMS88009. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-2-(6-methoxy-1-benzofuran-2-yl)ethenyl]-N,N-dimethylaniline (CAS 1089681-42-4) is a chemical compound with the molecular formula C19H19NO2 and a molecular weight of 293.4 g/mol. IUPAC name: 4-[(E)-2-(6-methoxy-1-benzofuran-2-yl)ethenyl]-N,N-dimethylaniline. InChIKey: GAAPZOXKUKNOPB-UXBLZVDNSA-N.
| Molecular formula | C19H19NO2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 4-[(E)-2-(6-methoxy-1-benzofuran-2-yl)ethenyl]-N,N-dimethylaniline |
| InChIKey | GAAPZOXKUKNOPB-UXBLZVDNSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C2=CC3=C(O2)C=C(C=C3)OC |
Computed by PubChem (NCBI)