CAS 1089989-56-9 is the registry number for 2-Bromo-n-2,3-dihydro-1,4-benzodioxin-6-ylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide (CAS 1089989-56-9) is a chemical compound with the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. IUPAC name: 2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide. InChIKey: PXEQJYTWAJEKNX-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3 |
|---|---|
| Molecular weight | 286.12 g/mol |
| IUPAC name | 2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide |
| InChIKey | PXEQJYTWAJEKNX-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC2=C(C=C1)OCCO2)Br |
Computed by PubChem (NCBI)