CAS 171095-12-8 appears in our catalog under these names: (S)-N-Acetyl-4-bromophenylalanine, 97%, (S)-2-Acetamido-3-(4-bromophenyl)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(2S)-2-acetamido-3-(4-bromophenyl)propanoic acid (CAS 171095-12-8) is a chemical compound with the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. IUPAC name: (2S)-2-acetamido-3-(4-bromophenyl)propanoic acid. InChIKey: LDCUXIARELPUCD-JTQLQIEISA-N.
| Molecular formula | C11H12BrNO3 |
|---|---|
| Molecular weight | 286.12 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(4-bromophenyl)propanoic acid |
| InChIKey | LDCUXIARELPUCD-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)