CAS 2065250-49-7 is the registry number for 4-Acetylamino-3-bromo-5-methyl-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-acetamido-3-bromo-5-methylbenzoate (CAS 2065250-49-7) is a chemical compound with the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. IUPAC name: methyl 4-acetamido-3-bromo-5-methylbenzoate. InChIKey: ZBRZZCHZXCOVCM-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3 |
|---|---|
| Molecular weight | 286.12 g/mol |
| IUPAC name | methyl 4-acetamido-3-bromo-5-methylbenzoate |
| InChIKey | ZBRZZCHZXCOVCM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)C)Br)C(=O)OC |
Computed by PubChem (NCBI)