Products 1099687-03-2
CAS 1099687-03-2 appears in our catalog under these names: 4–Bromo–2–morpholinobenzoic Acid, 4-Bromo-2-morpholinobenzoic acid, 98%, 4-Bromo-2-morpholinobenzoic acid, 95-<97%, 4-Bromo-2-morpholinobenzoic acid, ≥97-<99%, 4-Bromo-2-morpholinobenzoic Acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Hoffman Fine Chemicals. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 2g, 50g, 100g.
4-bromo-2-morpholin-4-ylbenzoic acid (CAS 1099687-03-2) is a chemical compound with the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. IUPAC name: 4-bromo-2-morpholin-4-ylbenzoic acid. InChIKey: FYELNCRQYNFNFO-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3 |
|---|---|
| Molecular weight | 286.12 g/mol |
| IUPAC name | 4-bromo-2-morpholin-4-ylbenzoic acid |
| InChIKey | FYELNCRQYNFNFO-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)