CAS 73721-76-3 is the registry number for 5-Bromo-2-butyramidobenzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-2-(butanoylamino)benzoic acid (CAS 73721-76-3) is a chemical compound with the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. IUPAC name: 5-bromo-2-(butanoylamino)benzoic acid. InChIKey: GXWCOUDKEAADOT-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3 |
|---|---|
| Molecular weight | 286.12 g/mol |
| IUPAC name | 5-bromo-2-(butanoylamino)benzoic acid |
| InChIKey | GXWCOUDKEAADOT-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=C(C=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)