Products 109060-64-2
CAS 109060-64-2 appears in our catalog under these names: 5-(3-Methylphenyl)-1,3,4-oxadiazol-2-amine, 5-(3-Methylphenyl)-1,3,4-oxadiazol-2-amine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1g, 250mg.
5-(3-methylphenyl)-1,3,4-oxadiazol-2-amine (CAS 109060-64-2) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 5-(3-methylphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: IYHZYSITDCSNBQ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 5-(3-methylphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | IYHZYSITDCSNBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)