CAS 1092022-18-8 is the registry number for 4-([(3,5-Dimethylphenyl)(methylsulfonyl)amino]methyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(3,5-dimethyl-N-methylsulfonylanilino)methyl]benzoic acid (CAS 1092022-18-8) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 4-[(3,5-dimethyl-N-methylsulfonylanilino)methyl]benzoic acid. InChIKey: CPJMJHNHSXLWFD-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 4-[(3,5-dimethyl-N-methylsulfonylanilino)methyl]benzoic acid |
| InChIKey | CPJMJHNHSXLWFD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N(CC2=CC=C(C=C2)C(=O)O)S(=O)(=O)C)C |
Computed by PubChem (NCBI)