CAS 1092279-03-2 appears in our catalog under these names: tert-Butyl hexahydrothieno[3,4-b]pyrazine-1(2H)-carboxylate 6,6-dioxide, 95%, tert-Butyl hexahydrothieno(3,4-b)pyrazine-1(2H)-carboxylate 6,6-dioxide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
Tert-butyl 6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxylate (CAS 1092279-03-2) is a chemical compound with the molecular formula C11H20N2O4S and a molecular weight of 276.35 g/mol. IUPAC name: tert-butyl 6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxylate. InChIKey: KOZDDZXSEPRNPZ-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O4S |
|---|---|
| Molecular weight | 276.35 g/mol |
| IUPAC name | tert-butyl 6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxylate |
| InChIKey | KOZDDZXSEPRNPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC2C1CS(=O)(=O)C2 |
Computed by PubChem (NCBI)