Products 1453315-64-4
CAS 1453315-64-4 is the registry number for tert-Butyl 8-amino-6-thia-2-azaspiro[3.4]octane-2-carboxylate 6,6-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 8-amino-6,6-dioxo-6lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate (CAS 1453315-64-4) is a chemical compound with the molecular formula C11H20N2O4S and a molecular weight of 276.35 g/mol. IUPAC name: tert-butyl 8-amino-6,6-dioxo-6lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate. InChIKey: HJKXBWRMXXDERA-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O4S |
|---|---|
| Molecular weight | 276.35 g/mol |
| IUPAC name | tert-butyl 8-amino-6,6-dioxo-6lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | HJKXBWRMXXDERA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CS(=O)(=O)CC2N |
Computed by PubChem (NCBI)