Products 2165696-64-8
CAS 2165696-64-8 is the registry number for tert-Butyl (S,E)-2-(2-sulfamoylvinyl)pyrrolidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-2-[(E)-2-sulfamoylethenyl]pyrrolidine-1-carboxylate (CAS 2165696-64-8) is a chemical compound with the molecular formula C11H20N2O4S and a molecular weight of 276.35 g/mol. IUPAC name: tert-butyl (2S)-2-[(E)-2-sulfamoylethenyl]pyrrolidine-1-carboxylate. InChIKey: NIASXSNPLHNDKA-ORZBULNSSA-N.
| Molecular formula | C11H20N2O4S |
|---|---|
| Molecular weight | 276.35 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(E)-2-sulfamoylethenyl]pyrrolidine-1-carboxylate |
| InChIKey | NIASXSNPLHNDKA-ORZBULNSSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1/C=C/S(=O)(=O)N |
Computed by PubChem (NCBI)