Products 2435623-10-0
CAS 2435623-10-0 is the registry number for tert-Butyl 2-thia-3,7-diazaspiro[4.4]nonane-7-carboxylate 2,2-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2,2-dioxo-2lambda6-thia-3,7-diazaspiro[4.4]nonane-7-carboxylate (CAS 2435623-10-0) is a chemical compound with the molecular formula C11H20N2O4S and a molecular weight of 276.35 g/mol. IUPAC name: tert-butyl 2,2-dioxo-2lambda6-thia-3,7-diazaspiro[4.4]nonane-7-carboxylate. InChIKey: YHCBNXPDKLKGQI-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O4S |
|---|---|
| Molecular weight | 276.35 g/mol |
| IUPAC name | tert-butyl 2,2-dioxo-2lambda6-thia-3,7-diazaspiro[4.4]nonane-7-carboxylate |
| InChIKey | YHCBNXPDKLKGQI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CNS(=O)(=O)C2 |
Computed by PubChem (NCBI)